C16H18O6 — CID 163066126
[6-[(2R)-2,3-dihydroxy-3-methylbutyl]-2-oxochromen-7-yl] acetate (PubChem CID 163066126) has the molecular formula C16H18O6 and a molecular weight of 306.31 g/mol. Its IUPAC name is [6-[(2R)-2,3-dihydroxy-3-methylbutyl]-2-oxochromen-7-yl] acetate.
| Compound Name | [6-[(2R)-2,3-dihydroxy-3-methylbutyl]-2-oxochromen-7-yl] acetate |
|---|---|
| PubChem CID | 163066126 |
| Molecular Formula | C16H18O6 |
| Molecular Weight | 306.31 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | [6-[(2R)-2,3-dihydroxy-3-methylbutyl]-2-oxochromen-7-yl] acetate |
| SMILES | CC(=O)Oc1cc2oc(=O)ccc2cc1C[C@@H](O)C(C)(C)O |
| InChI | InChI=1S/C16H18O6/c1-9(17)21-13-8-12-10(4-5-15(19)22-12)6-11(13)7-14(18)16(2,3)20/h4-6,8,14,18,20H,7H2,1-3H3/t14-/m1/s1 |
| InChIKey | OPRXCJBCJIGNPA-CQSZACIVSA-N |
| XLogP | 1.39 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.31 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|