C19H24O5 — CID 163027378
6-[(2S)-2,3-dihydroxy-3-methylbutyl]-7-hydroxy-8-(3-methylbut-2-enyl)chromen-2-one (PubChem CID 163027378) has the molecular formula C19H24O5 and a molecular weight of 332.40 g/mol. Its IUPAC name is 6-[(2S)-2,3-dihydroxy-3-methylbutyl]-7-hydroxy-8-(3-methylbut-2-enyl)chromen-2-one.
| Compound Name | 6-[(2S)-2,3-dihydroxy-3-methylbutyl]-7-hydroxy-8-(3-methylbut-2-enyl)chromen-2-one |
|---|---|
| PubChem CID | 163027378 |
| Molecular Formula | C19H24O5 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | 6-[(2S)-2,3-dihydroxy-3-methylbutyl]-7-hydroxy-8-(3-methylbut-2-enyl)chromen-2-one |
| SMILES | CC(C)=CCc1c(O)c(C[C@H](O)C(C)(C)O)cc2ccc(=O)oc12 |
| InChI | InChI=1S/C19H24O5/c1-11(2)5-7-14-17(22)13(10-15(20)19(3,4)23)9-12-6-8-16(21)24-18(12)14/h5-6,8-9,15,20,22-23H,7,10H2,1-4H3/t15-/m0/s1 |
| InChIKey | GQKIKZRGVFXRKJ-HNNXBMFYSA-N |
| XLogP | 2.68 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|