C38H46O8 — CID 164628722
[(2S)-3-hydroxy-3-methyl-1-[7-(3-methylbut-2-enoxy)-2-oxochromen-8-yl]butan-2-yl] (E)-3-[5-[(2E)-3,7-dimethylocta-2,6-dienyl]-2,4-dihydroxyphenyl]prop-2-enoate (PubChem CID 164628722) has the molecular formula C38H46O8 and a molecular weight of 630.78 g/mol. Its IUPAC name is [(2S)-3-hydroxy-3-methyl-1-[7-(3-methylbut-2-enoxy)-2-oxochromen-8-yl]butan-2-yl] (E)-3-[5-[(2E)-3,7-dimethylocta-2,6-dienyl]-2,4-dihydroxyphenyl]prop-2-enoate.
| Compound Name | [(2S)-3-hydroxy-3-methyl-1-[7-(3-methylbut-2-enoxy)-2-oxochromen-8-yl]butan-2-yl] (E)-3-[5-[(2E)-3,7-dimethylocta-2,6-dienyl]-2,4-dihydroxyphenyl]prop-2-enoate |
|---|---|
| PubChem CID | 164628722 |
| Molecular Formula | C38H46O8 |
| Molecular Weight | 630.78 g/mol |
| Exact Mass | 630.32 |
| IUPAC Name | [(2S)-3-hydroxy-3-methyl-1-[7-(3-methylbut-2-enoxy)-2-oxochromen-8-yl]butan-2-yl] (E)-3-[5-[(2E)-3,7-dimethylocta-2,6-dienyl]-2,4-dihydroxyphenyl]prop-2-enoate |
| SMILES | CC(C)=CCC/C(C)=C/Cc1cc(/C=C/C(=O)O[C@@H](Cc2c(OCC=C(C)C)ccc3ccc(=O)oc23)C(C)(C)O)c(O)cc1O |
| InChI | InChI=1S/C38H46O8/c1-24(2)9-8-10-26(5)11-12-28-21-29(32(40)23-31(28)39)15-18-35(41)45-34(38(6,7)43)22-30-33(44-20-19-25(3)4)16-13-27-14-17-36(42)46-37(27)30/h9,11,13-19,21,23,34,39-40,43H,8,10,12,20,22H2,1-7H3/b18-15+,26-11+/t34-/m0/s1 |
| InChIKey | JRYGHKWUMMUDLF-PLEWPLBISA-N |
| XLogP | 7.72 |
| TPSA | 126.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.78 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|