C29H38O3 — CID 122362393
3,6-bis[(2E)-3,7-dimethylocta-2,6-dienyl]-7-hydroxychromen-2-one (PubChem CID 122362393) has the molecular formula C29H38O3 and a molecular weight of 434.62 g/mol. Its IUPAC name is 3,6-bis[(2E)-3,7-dimethylocta-2,6-dienyl]-7-hydroxychromen-2-one.
| Compound Name | 3,6-bis[(2E)-3,7-dimethylocta-2,6-dienyl]-7-hydroxychromen-2-one |
|---|---|
| PubChem CID | 122362393 |
| Molecular Formula | C29H38O3 |
| Molecular Weight | 434.62 g/mol |
| Exact Mass | 434.28 |
| IUPAC Name | 3,6-bis[(2E)-3,7-dimethylocta-2,6-dienyl]-7-hydroxychromen-2-one |
| SMILES | CC(C)=CCC/C(C)=C/Cc1cc2cc(C/C=C(\C)CCC=C(C)C)c(=O)oc2cc1O |
| InChI | InChI=1S/C29H38O3/c1-20(2)9-7-11-22(5)13-15-24-17-26-18-25(29(31)32-28(26)19-27(24)30)16-14-23(6)12-8-10-21(3)4/h9-10,13-14,17-19,30H,7-8,11-12,15-16H2,1-6H3/b22-13+,23-14+ |
| InChIKey | MTBRFWOJBXIYEH-MSKUYSOUSA-N |
| XLogP | 7.97 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.62 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|