C17H24O2 — CID 586140
2-(3,7-dimethylocta-2,6-dienyl)-4-methoxyphenol (PubChem CID 586140) has the molecular formula C17H24O2 and a molecular weight of 260.38 g/mol. Its IUPAC name is 2-(3,7-dimethylocta-2,6-dienyl)-4-methoxyphenol.
| Compound Name | 2-(3,7-dimethylocta-2,6-dienyl)-4-methoxyphenol |
|---|---|
| PubChem CID | 586140 |
| Molecular Formula | C17H24O2 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | 2-(3,7-dimethylocta-2,6-dienyl)-4-methoxyphenol |
| SMILES | COc1ccc(O)c(CC=C(C)CCC=C(C)C)c1 |
| InChI | InChI=1S/C17H24O2/c1-13(2)6-5-7-14(3)8-9-15-12-16(19-4)10-11-17(15)18/h6,8,10-12,18H,5,7,9H2,1-4H3 |
| InChIKey | MABMJUYMGMQGEA-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|