C24H34O3 — CID 11394616
ethyl 4-hydroxy-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]benzoate (PubChem CID 11394616) has the molecular formula C24H34O3 and a molecular weight of 370.53 g/mol. Its IUPAC name is ethyl 4-hydroxy-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]benzoate.
| Compound Name | ethyl 4-hydroxy-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]benzoate |
|---|---|
| PubChem CID | 11394616 |
| Molecular Formula | C24H34O3 |
| Molecular Weight | 370.53 g/mol |
| Exact Mass | 370.25 |
| IUPAC Name | ethyl 4-hydroxy-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]benzoate |
| SMILES | CCOC(=O)c1ccc(O)c(C/C=C(\C)CC/C=C(\C)CCC=C(C)C)c1 |
| InChI | InChI=1S/C24H34O3/c1-6-27-24(26)22-15-16-23(25)21(17-22)14-13-20(5)12-8-11-19(4)10-7-9-18(2)3/h9,11,13,15-17,25H,6-8,10,12,14H2,1-5H3/b19-11+,20-13+ |
| InChIKey | ISTAHQPSIUTVKU-UFTLRZAHSA-N |
| XLogP | 6.53 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.53 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|