C17H24N2O — CID 132934685
4-amino-3-[(2E)-3,7-dimethylocta-2,6-dienyl]benzamide (PubChem CID 132934685) has the molecular formula C17H24N2O and a molecular weight of 272.39 g/mol. Its IUPAC name is 4-amino-3-[(2E)-3,7-dimethylocta-2,6-dienyl]benzamide.
| Compound Name | 4-amino-3-[(2E)-3,7-dimethylocta-2,6-dienyl]benzamide |
|---|---|
| PubChem CID | 132934685 |
| Molecular Formula | C17H24N2O |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | 4-amino-3-[(2E)-3,7-dimethylocta-2,6-dienyl]benzamide |
| SMILES | CC(C)=CCC/C(C)=C/Cc1cc(C(N)=O)ccc1N |
| InChI | InChI=1S/C17H24N2O/c1-12(2)5-4-6-13(3)7-8-14-11-15(17(19)20)9-10-16(14)18/h5,7,9-11H,4,6,8,18H2,1-3H3,(H2,19,20)/b13-7+ |
| InChIKey | PSLRCPDCCRSFGF-NTUHNPAUSA-N |
| XLogP | 3.60 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|