C27H38O3 — CID 85102852
3,5-bis(3,7-dimethylocta-2,6-dienyl)-4-hydroxybenzoic acid (PubChem CID 85102852) has the molecular formula C27H38O3 and a molecular weight of 410.60 g/mol. Its IUPAC name is 3,5-bis(3,7-dimethylocta-2,6-dienyl)-4-hydroxybenzoic acid.
| Compound Name | 3,5-bis(3,7-dimethylocta-2,6-dienyl)-4-hydroxybenzoic acid |
|---|---|
| PubChem CID | 85102852 |
| Molecular Formula | C27H38O3 |
| Molecular Weight | 410.60 g/mol |
| Exact Mass | 410.28 |
| IUPAC Name | 3,5-bis(3,7-dimethylocta-2,6-dienyl)-4-hydroxybenzoic acid |
| SMILES | CC(C)=CCCC(C)=CCc1cc(C(=O)O)cc(CC=C(C)CCC=C(C)C)c1O |
| InChI | InChI=1S/C27H38O3/c1-19(2)9-7-11-21(5)13-15-23-17-25(27(29)30)18-24(26(23)28)16-14-22(6)12-8-10-20(3)4/h9-10,13-14,17-18,28H,7-8,11-12,15-16H2,1-6H3,(H,29,30) |
| InChIKey | AMJQNZOGATWKJX-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.60 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|