C24H32O3 — CID 101244828
(E)-3-[3-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-hydroxy-5-(3-methylbut-2-enyl)phenyl]prop-2-enoic acid (PubChem CID 101244828) has the molecular formula C24H32O3 and a molecular weight of 368.52 g/mol. Its IUPAC name is (E)-3-[3-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-hydroxy-5-(3-methylbut-2-enyl)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-hydroxy-5-(3-methylbut-2-enyl)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 101244828 |
| Molecular Formula | C24H32O3 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.24 |
| IUPAC Name | (E)-3-[3-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-hydroxy-5-(3-methylbut-2-enyl)phenyl]prop-2-enoic acid |
| SMILES | CC(C)=CCC/C(C)=C/Cc1cc(/C=C/C(=O)O)cc(CC=C(C)C)c1O |
| InChI | InChI=1S/C24H32O3/c1-17(2)7-6-8-19(5)10-13-22-16-20(11-14-23(25)26)15-21(24(22)27)12-9-18(3)4/h7,9-11,14-16,27H,6,8,12-13H2,1-5H3,(H,25,26)/b14-11+,19-10+ |
| InChIKey | MGODIMOMPNCGTL-UTEUGLLLSA-N |
| XLogP | 6.23 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|