C23H34O2 — CID 90355725
3,4-dimethyl-6-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]benzene-1,2-diol (PubChem CID 90355725) has the molecular formula C23H34O2 and a molecular weight of 342.52 g/mol. Its IUPAC name is 3,4-dimethyl-6-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]benzene-1,2-diol.
| Compound Name | 3,4-dimethyl-6-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 90355725 |
| Molecular Formula | C23H34O2 |
| Molecular Weight | 342.52 g/mol |
| Exact Mass | 342.26 |
| IUPAC Name | 3,4-dimethyl-6-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]benzene-1,2-diol |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/Cc1cc(C)c(C)c(O)c1O |
| InChI | InChI=1S/C23H34O2/c1-16(2)9-7-10-17(3)11-8-12-18(4)13-14-21-15-19(5)20(6)22(24)23(21)25/h9,11,13,15,24-25H,7-8,10,12,14H2,1-6H3/b17-11+,18-13+ |
| InChIKey | IGJZGEXGEUBWJU-OUBUNXTGSA-N |
| XLogP | 6.68 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.52 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|