C27H32O4 — CID 68739020
methyl 4-[(E)-2-[3-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-hydroxy-5-methoxyphenyl]ethenyl]benzoate (PubChem CID 68739020) has the molecular formula C27H32O4 and a molecular weight of 420.55 g/mol. Its IUPAC name is methyl 4-[(E)-2-[3-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-hydroxy-5-methoxyphenyl]ethenyl]benzoate.
| Compound Name | methyl 4-[(E)-2-[3-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-hydroxy-5-methoxyphenyl]ethenyl]benzoate |
|---|---|
| PubChem CID | 68739020 |
| Molecular Formula | C27H32O4 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | methyl 4-[(E)-2-[3-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-hydroxy-5-methoxyphenyl]ethenyl]benzoate |
| SMILES | COC(=O)c1ccc(/C=C/c2cc(C/C=C(\C)CCC=C(C)C)c(O)c(OC)c2)cc1 |
| InChI | InChI=1S/C27H32O4/c1-19(2)7-6-8-20(3)9-14-24-17-22(18-25(30-4)26(24)28)11-10-21-12-15-23(16-13-21)27(29)31-5/h7,9-13,15-18,28H,6,8,14H2,1-5H3/b11-10+,20-9+ |
| InChIKey | WGYGYUFJMJHQES-KZLOIQJBSA-N |
| XLogP | 6.59 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|