C18H26O6 — CID 126649576
(2E)-3,7-dimethylocta-2,6-dien-1-ol;methyl 3,4,5-trihydroxybenzoate (PubChem CID 126649576) has the molecular formula C18H26O6 and a molecular weight of 338.40 g/mol. Its IUPAC name is (2E)-3,7-dimethylocta-2,6-dien-1-ol;methyl 3,4,5-trihydroxybenzoate.
| Compound Name | (2E)-3,7-dimethylocta-2,6-dien-1-ol;methyl 3,4,5-trihydroxybenzoate |
|---|---|
| PubChem CID | 126649576 |
| Molecular Formula | C18H26O6 |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | (2E)-3,7-dimethylocta-2,6-dien-1-ol;methyl 3,4,5-trihydroxybenzoate |
| SMILES | CC(C)=CCC/C(C)=C/CO.COC(=O)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C10H18O.C8H8O5/c1-9(2)5-4-6-10(3)7-8-11;1-13-8(12)4-2-5(9)7(11)6(10)3-4/h5,7,11H,4,6,8H2,1-3H3;2-3,9-11H,1H3/b10-7+; |
| InChIKey | ZVCQKWDNCVSNIA-HCUGZAAXSA-N |
| XLogP | 3.26 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|