C13H20O10 — CID 126649487
methyl 3,4,5-trihydroxybenzoate;pentane-1,2,3,4,5-pentol (PubChem CID 126649487) has the molecular formula C13H20O10 and a molecular weight of 336.29 g/mol. Its IUPAC name is methyl 3,4,5-trihydroxybenzoate;pentane-1,2,3,4,5-pentol.
| Compound Name | methyl 3,4,5-trihydroxybenzoate;pentane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 126649487 |
| Molecular Formula | C13H20O10 |
| Molecular Weight | 336.29 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | methyl 3,4,5-trihydroxybenzoate;pentane-1,2,3,4,5-pentol |
| SMILES | COC(=O)c1cc(O)c(O)c(O)c1.OCC(O)C(O)C(O)CO |
| InChI | InChI=1S/C8H8O5.C5H12O5/c1-13-8(12)4-2-5(9)7(11)6(10)3-4;6-1-3(8)5(10)4(9)2-7/h2-3,9-11H,1H3;3-10H,1-2H2 |
| InChIKey | WFCSRCCKDCHJKT-UHFFFAOYSA-N |
| XLogP | -2.36 |
| TPSA | 188.14 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.29 |
| LogP ≤ 5 | -2.36 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|