C11H14O6 — CID 170818438
methyl 2-hydroxy-5-(1,2,3-trihydroxypropyl)benzoate (PubChem CID 170818438) has the molecular formula C11H14O6 and a molecular weight of 242.23 g/mol. Its IUPAC name is methyl 2-hydroxy-5-(1,2,3-trihydroxypropyl)benzoate.
| Compound Name | methyl 2-hydroxy-5-(1,2,3-trihydroxypropyl)benzoate |
|---|---|
| PubChem CID | 170818438 |
| Molecular Formula | C11H14O6 |
| Molecular Weight | 242.23 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | methyl 2-hydroxy-5-(1,2,3-trihydroxypropyl)benzoate |
| SMILES | COC(=O)c1cc(C(O)C(O)CO)ccc1O |
| InChI | InChI=1S/C11H14O6/c1-17-11(16)7-4-6(2-3-8(7)13)10(15)9(14)5-12/h2-4,9-10,12-15H,5H2,1H3 |
| InChIKey | GOOMZPLRNPFLOB-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.23 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |