methyl 4-(3-amino-1,2-dihydroxypropyl)-2-hydroxybenzoate

C11H15NO5 — CID 170828633

IUPACmethyl 4-(3-amino-1,2-dihydroxypropyl)-2-hydroxybenzoate
SMILESCOC(=O)c1ccc(C(O)C(O)CN)cc1O
InChIInChI=1S/C11H15NO5/c1-17-11(16)7-3-2-6(4-8(7)13)10(15)9(14)5-12/h2-4,9-10,13-15H,5,12H2,1H3
InChIKeyYURTVZHCJFLLKY-UHFFFAOYSA-N
MW241.24 g/mol
LogP-0.47
Rot. Bonds4

About methyl 4-(3-amino-1,2-dihydroxypropyl)-2-hydroxybenzoate

methyl 4-(3-amino-1,2-dihydroxypropyl)-2-hydroxybenzoate (PubChem CID 170828633) has the molecular formula C11H15NO5 and a molecular weight of 241.24 g/mol. Its IUPAC name is methyl 4-(3-amino-1,2-dihydroxypropyl)-2-hydroxybenzoate.

Molecular Properties

Compound Namemethyl 4-(3-amino-1,2-dihydroxypropyl)-2-hydroxybenzoate
PubChem CID170828633
Molecular FormulaC11H15NO5
Molecular Weight241.24 g/mol
Exact Mass241.10
IUPAC Namemethyl 4-(3-amino-1,2-dihydroxypropyl)-2-hydroxybenzoate
SMILESCOC(=O)c1ccc(C(O)C(O)CN)cc1O
InChIInChI=1S/C11H15NO5/c1-17-11(16)7-3-2-6(4-8(7)13)10(15)9(14)5-12/h2-4,9-10,13-15H,5,12H2,1H3
InChIKeyYURTVZHCJFLLKY-UHFFFAOYSA-N
XLogP-0.47
TPSA113.01 Ų
H-Bond Donors4
H-Bond Acceptors6
Rotatable Bonds4
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500241.24
LogP ≤ 5-0.47
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 106

Analyze methyl 4-(3-amino-1,2-dihydroxypropyl)-2-hydroxybenzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-(3-amino-1,2-dihydroxypropyl)-2-hydroxybenzoate?
The IUPAC name of methyl 4-(3-amino-1,2-dihydroxypropyl)-2-hydroxybenzoate (CID 170828633) is methyl 4-(3-amino-1,2-dihydroxypropyl)-2-hydroxybenzoate.
What is the SMILES notation for methyl 4-(3-amino-1,2-dihydroxypropyl)-2-hydroxybenzoate?
The canonical SMILES for methyl 4-(3-amino-1,2-dihydroxypropyl)-2-hydroxybenzoate is COC(=O)c1ccc(C(O)C(O)CN)cc1O.
What is the InChIKey of methyl 4-(3-amino-1,2-dihydroxypropyl)-2-hydroxybenzoate?
The InChIKey is YURTVZHCJFLLKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO5/c1-17-11(16)7-3-2-6(4-8(7)13)10(15)9(14)5-12/h2-4,9-10,13-15H,5,12H2,1H3.
What are the key properties of methyl 4-(3-amino-1,2-dihydroxypropyl)-2-hydroxybenzoate?
methyl 4-(3-amino-1,2-dihydroxypropyl)-2-hydroxybenzoate has a molecular weight of 241.24 g/mol, XLogP of -0.47, 4 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(3-amino-1,2-dihydroxypropyl)-2-hydroxybenzoate is sourced from PubChem (CID 170828633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).