C11H13ClO4 — CID 171862332
1-[4-(3-chloro-1,2-dihydroxypropyl)-2-hydroxyphenyl]ethanone (PubChem CID 171862332) has the molecular formula C11H13ClO4 and a molecular weight of 244.67 g/mol. Its IUPAC name is 1-[4-(3-chloro-1,2-dihydroxypropyl)-2-hydroxyphenyl]ethanone.
| Compound Name | 1-[4-(3-chloro-1,2-dihydroxypropyl)-2-hydroxyphenyl]ethanone |
|---|---|
| PubChem CID | 171862332 |
| Molecular Formula | C11H13ClO4 |
| Molecular Weight | 244.67 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | 1-[4-(3-chloro-1,2-dihydroxypropyl)-2-hydroxyphenyl]ethanone |
| SMILES | CC(=O)c1ccc(C(O)C(O)CCl)cc1O |
| InChI | InChI=1S/C11H13ClO4/c1-6(13)8-3-2-7(4-9(8)14)11(16)10(15)5-12/h2-4,10-11,14-16H,5H2,1H3 |
| InChIKey | NVBFRMLMMZEMKC-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.67 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|