C12H14Cl2O4 — CID 171894353
methyl 2-chloro-4-(4-chloro-1,2-dihydroxybutyl)benzoate (PubChem CID 171894353) has the molecular formula C12H14Cl2O4 and a molecular weight of 293.15 g/mol. Its IUPAC name is methyl 2-chloro-4-(4-chloro-1,2-dihydroxybutyl)benzoate.
| Compound Name | methyl 2-chloro-4-(4-chloro-1,2-dihydroxybutyl)benzoate |
|---|---|
| PubChem CID | 171894353 |
| Molecular Formula | C12H14Cl2O4 |
| Molecular Weight | 293.15 g/mol |
| Exact Mass | 292.03 |
| IUPAC Name | methyl 2-chloro-4-(4-chloro-1,2-dihydroxybutyl)benzoate |
| SMILES | COC(=O)c1ccc(C(O)C(O)CCCl)cc1Cl |
| InChI | InChI=1S/C12H14Cl2O4/c1-18-12(17)8-3-2-7(6-9(8)14)11(16)10(15)4-5-13/h2-3,6,10-11,15-16H,4-5H2,1H3 |
| InChIKey | RGZNVQOKPUAQJT-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.15 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|