C11H14Cl2O3 — CID 171893697
4-chloro-1-(4-chloro-3-methoxyphenyl)butane-1,2-diol (PubChem CID 171893697) has the molecular formula C11H14Cl2O3 and a molecular weight of 265.14 g/mol. Its IUPAC name is 4-chloro-1-(4-chloro-3-methoxyphenyl)butane-1,2-diol.
| Compound Name | 4-chloro-1-(4-chloro-3-methoxyphenyl)butane-1,2-diol |
|---|---|
| PubChem CID | 171893697 |
| Molecular Formula | C11H14Cl2O3 |
| Molecular Weight | 265.14 g/mol |
| Exact Mass | 264.03 |
| IUPAC Name | 4-chloro-1-(4-chloro-3-methoxyphenyl)butane-1,2-diol |
| SMILES | COc1cc(C(O)C(O)CCCl)ccc1Cl |
| InChI | InChI=1S/C11H14Cl2O3/c1-16-10-6-7(2-3-8(10)13)11(15)9(14)4-5-12/h2-3,6,9,11,14-15H,4-5H2,1H3 |
| InChIKey | RJRKMDJBLVWPPD-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.14 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|