C12H14Cl2O4 — CID 171894337
2-[2-chloro-5-(4-chloro-1,2-dihydroxybutyl)phenyl]acetic acid (PubChem CID 171894337) has the molecular formula C12H14Cl2O4 and a molecular weight of 293.15 g/mol. Its IUPAC name is 2-[2-chloro-5-(4-chloro-1,2-dihydroxybutyl)phenyl]acetic acid.
| Compound Name | 2-[2-chloro-5-(4-chloro-1,2-dihydroxybutyl)phenyl]acetic acid |
|---|---|
| PubChem CID | 171894337 |
| Molecular Formula | C12H14Cl2O4 |
| Molecular Weight | 293.15 g/mol |
| Exact Mass | 292.03 |
| IUPAC Name | 2-[2-chloro-5-(4-chloro-1,2-dihydroxybutyl)phenyl]acetic acid |
| SMILES | O=C(O)Cc1cc(C(O)C(O)CCCl)ccc1Cl |
| InChI | InChI=1S/C12H14Cl2O4/c13-4-3-10(15)12(18)7-1-2-9(14)8(5-7)6-11(16)17/h1-2,5,10,12,15,18H,3-4,6H2,(H,16,17) |
| InChIKey | JFRQFQYAQHUSLO-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.15 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|