C10H12Cl2O3 — CID 171861934
3-chloro-1-[4-chloro-3-(hydroxymethyl)phenyl]propane-1,2-diol (PubChem CID 171861934) has the molecular formula C10H12Cl2O3 and a molecular weight of 251.11 g/mol. Its IUPAC name is 3-chloro-1-[4-chloro-3-(hydroxymethyl)phenyl]propane-1,2-diol.
| Compound Name | 3-chloro-1-[4-chloro-3-(hydroxymethyl)phenyl]propane-1,2-diol |
|---|---|
| PubChem CID | 171861934 |
| Molecular Formula | C10H12Cl2O3 |
| Molecular Weight | 251.11 g/mol |
| Exact Mass | 250.02 |
| IUPAC Name | 3-chloro-1-[4-chloro-3-(hydroxymethyl)phenyl]propane-1,2-diol |
| SMILES | OCc1cc(C(O)C(O)CCl)ccc1Cl |
| InChI | InChI=1S/C10H12Cl2O3/c11-4-9(14)10(15)6-1-2-8(12)7(3-6)5-13/h1-3,9-10,13-15H,4-5H2 |
| InChIKey | XHCNUBQPPFAWCE-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.11 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|