C12H11Cl2NO2 — CID 171862802
3-chloro-1-(4-chloroquinolin-7-yl)propane-1,2-diol (PubChem CID 171862802) has the molecular formula C12H11Cl2NO2 and a molecular weight of 272.13 g/mol. Its IUPAC name is 3-chloro-1-(4-chloroquinolin-7-yl)propane-1,2-diol.
| Compound Name | 3-chloro-1-(4-chloroquinolin-7-yl)propane-1,2-diol |
|---|---|
| PubChem CID | 171862802 |
| Molecular Formula | C12H11Cl2NO2 |
| Molecular Weight | 272.13 g/mol |
| Exact Mass | 271.02 |
| IUPAC Name | 3-chloro-1-(4-chloroquinolin-7-yl)propane-1,2-diol |
| SMILES | OC(CCl)C(O)c1ccc2c(Cl)ccnc2c1 |
| InChI | InChI=1S/C12H11Cl2NO2/c13-6-11(16)12(17)7-1-2-8-9(14)3-4-15-10(8)5-7/h1-5,11-12,16-17H,6H2 |
| InChIKey | DLUQHYRJAWOZGL-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.13 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|