C12H11Cl2NO3 — CID 171863193
3-chloro-1-(5-chloro-8-hydroxyquinolin-7-yl)propane-1,2-diol (PubChem CID 171863193) has the molecular formula C12H11Cl2NO3 and a molecular weight of 288.13 g/mol. Its IUPAC name is 3-chloro-1-(5-chloro-8-hydroxyquinolin-7-yl)propane-1,2-diol.
| Compound Name | 3-chloro-1-(5-chloro-8-hydroxyquinolin-7-yl)propane-1,2-diol |
|---|---|
| PubChem CID | 171863193 |
| Molecular Formula | C12H11Cl2NO3 |
| Molecular Weight | 288.13 g/mol |
| Exact Mass | 287.01 |
| IUPAC Name | 3-chloro-1-(5-chloro-8-hydroxyquinolin-7-yl)propane-1,2-diol |
| SMILES | Oc1c(C(O)C(O)CCl)cc(Cl)c2cccnc12 |
| InChI | InChI=1S/C12H11Cl2NO3/c13-5-9(16)11(17)7-4-8(14)6-2-1-3-15-10(6)12(7)18/h1-4,9,11,16-18H,5H2 |
| InChIKey | KNGRSWWQCXRYFG-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.13 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|