C21H25ClN4O+2 — CID 7762088
5-chloro-7-[(S)-(4-ethylpiperazine-1,4-diium-1-yl)-pyridin-2-ylmethyl]quinolin-8-ol (PubChem CID 7762088) has the molecular formula C21H25ClN4O+2 and a molecular weight of 384.91 g/mol. Its IUPAC name is 5-chloro-7-[(S)-(4-ethylpiperazine-1,4-diium-1-yl)-pyridin-2-ylmethyl]quinolin-8-ol.
| Compound Name | 5-chloro-7-[(S)-(4-ethylpiperazine-1,4-diium-1-yl)-pyridin-2-ylmethyl]quinolin-8-ol |
|---|---|
| PubChem CID | 7762088 |
| Molecular Formula | C21H25ClN4O+2 |
| Molecular Weight | 384.91 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | 5-chloro-7-[(S)-(4-ethylpiperazine-1,4-diium-1-yl)-pyridin-2-ylmethyl]quinolin-8-ol |
| SMILES | CC[NH+]1CC[NH+]([C@H](c2ccccn2)c2cc(Cl)c3cccnc3c2O)CC1 |
| InChI | InChI=1S/C21H23ClN4O/c1-2-25-10-12-26(13-11-25)20(18-7-3-4-8-23-18)16-14-17(22)15-6-5-9-24-19(15)21(16)27/h3-9,14,20,27H,2,10-13H2,1H3/p+2/t20-/m0/s1 |
| InChIKey | VVUDRIJJENVYNV-FQEVSTJZSA-P |
| XLogP | 0.88 |
| TPSA | 54.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.91 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|