C19H20ClN3O+2 — CID 4131767
5-chloro-7-[pyridin-2-yl(pyrrolidin-1-ium-1-yl)methyl]quinolin-1-ium-8-ol (PubChem CID 4131767) has the molecular formula C19H20ClN3O+2 and a molecular weight of 341.84 g/mol. Its IUPAC name is 5-chloro-7-[pyridin-2-yl(pyrrolidin-1-ium-1-yl)methyl]quinolin-1-ium-8-ol.
| Compound Name | 5-chloro-7-[pyridin-2-yl(pyrrolidin-1-ium-1-yl)methyl]quinolin-1-ium-8-ol |
|---|---|
| PubChem CID | 4131767 |
| Molecular Formula | C19H20ClN3O+2 |
| Molecular Weight | 341.84 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | 5-chloro-7-[pyridin-2-yl(pyrrolidin-1-ium-1-yl)methyl]quinolin-1-ium-8-ol |
| SMILES | Oc1c(C(c2ccccn2)[NH+]2CCCC2)cc(Cl)c2ccc[nH+]c12 |
| InChI | InChI=1S/C19H18ClN3O/c20-15-12-14(19(24)17-13(15)6-5-9-22-17)18(23-10-3-4-11-23)16-7-1-2-8-21-16/h1-2,5-9,12,18,24H,3-4,10-11H2/p+2 |
| InChIKey | QLPZJTVSRZEZHY-UHFFFAOYSA-P |
| XLogP | 2.18 |
| TPSA | 51.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.84 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|