C26H27ClN4O+2 — CID 4141169
5-chloro-7-[(4-methylphenyl)-(4-pyridin-2-ylpiperazin-1-ium-1-yl)methyl]quinolin-1-ium-8-ol (PubChem CID 4141169) has the molecular formula C26H27ClN4O+2 and a molecular weight of 446.98 g/mol. Its IUPAC name is 5-chloro-7-[(4-methylphenyl)-(4-pyridin-2-ylpiperazin-1-ium-1-yl)methyl]quinolin-1-ium-8-ol.
| Compound Name | 5-chloro-7-[(4-methylphenyl)-(4-pyridin-2-ylpiperazin-1-ium-1-yl)methyl]quinolin-1-ium-8-ol |
|---|---|
| PubChem CID | 4141169 |
| Molecular Formula | C26H27ClN4O+2 |
| Molecular Weight | 446.98 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | 5-chloro-7-[(4-methylphenyl)-(4-pyridin-2-ylpiperazin-1-ium-1-yl)methyl]quinolin-1-ium-8-ol |
| SMILES | Cc1ccc(C(c2cc(Cl)c3ccc[nH+]c3c2O)[NH+]2CCN(c3ccccn3)CC2)cc1 |
| InChI | InChI=1S/C26H25ClN4O/c1-18-7-9-19(10-8-18)25(21-17-22(27)20-5-4-12-29-24(20)26(21)32)31-15-13-30(14-16-31)23-6-2-3-11-28-23/h2-12,17,25,32H,13-16H2,1H3/p+2 |
| InChIKey | DNDQEZSOXMZIBM-UHFFFAOYSA-P |
| XLogP | 3.21 |
| TPSA | 54.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.98 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|