C19H21ClN4O+2 — CID 4753258
5-chloro-7-[(4-pyridin-2-ylpiperazin-1-ium-1-yl)methyl]quinolin-1-ium-8-ol (PubChem CID 4753258) has the molecular formula C19H21ClN4O+2 and a molecular weight of 356.86 g/mol. Its IUPAC name is 5-chloro-7-[(4-pyridin-2-ylpiperazin-1-ium-1-yl)methyl]quinolin-1-ium-8-ol.
| Compound Name | 5-chloro-7-[(4-pyridin-2-ylpiperazin-1-ium-1-yl)methyl]quinolin-1-ium-8-ol |
|---|---|
| PubChem CID | 4753258 |
| Molecular Formula | C19H21ClN4O+2 |
| Molecular Weight | 356.86 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | 5-chloro-7-[(4-pyridin-2-ylpiperazin-1-ium-1-yl)methyl]quinolin-1-ium-8-ol |
| SMILES | Oc1c(C[NH+]2CCN(c3ccccn3)CC2)cc(Cl)c2ccc[nH+]c12 |
| InChI | InChI=1S/C19H19ClN4O/c20-16-12-14(19(25)18-15(16)4-3-7-22-18)13-23-8-10-24(11-9-23)17-5-1-2-6-21-17/h1-7,12,25H,8-11,13H2/p+2 |
| InChIKey | OPEJNANYABTIGC-UHFFFAOYSA-P |
| XLogP | 1.31 |
| TPSA | 54.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.86 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|