C16H16ClN3O4S — CID 4836430
2-chloro-5-(4-pyridin-2-ylpiperazin-1-yl)sulfonylbenzoic acid (PubChem CID 4836430) has the molecular formula C16H16ClN3O4S and a molecular weight of 381.84 g/mol. Its IUPAC name is 2-chloro-5-(4-pyridin-2-ylpiperazin-1-yl)sulfonylbenzoic acid.
| Compound Name | 2-chloro-5-(4-pyridin-2-ylpiperazin-1-yl)sulfonylbenzoic acid |
|---|---|
| PubChem CID | 4836430 |
| Molecular Formula | C16H16ClN3O4S |
| Molecular Weight | 381.84 g/mol |
| Exact Mass | 381.06 |
| IUPAC Name | 2-chloro-5-(4-pyridin-2-ylpiperazin-1-yl)sulfonylbenzoic acid |
| SMILES | O=C(O)c1cc(S(=O)(=O)N2CCN(c3ccccn3)CC2)ccc1Cl |
| InChI | InChI=1S/C16H16ClN3O4S/c17-14-5-4-12(11-13(14)16(21)22)25(23,24)20-9-7-19(8-10-20)15-3-1-2-6-18-15/h1-6,11H,7-10H2,(H,21,22) |
| InChIKey | AMCPRMNUFDIRCP-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 90.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.84 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |