C22H23N3O4S — CID 172910349
formic acid;1-(3-phenylphenyl)sulfonyl-4-pyridin-2-ylpiperazine (PubChem CID 172910349) has the molecular formula C22H23N3O4S and a molecular weight of 425.51 g/mol. Its IUPAC name is formic acid;1-(3-phenylphenyl)sulfonyl-4-pyridin-2-ylpiperazine.
| Compound Name | formic acid;1-(3-phenylphenyl)sulfonyl-4-pyridin-2-ylpiperazine |
|---|---|
| PubChem CID | 172910349 |
| Molecular Formula | C22H23N3O4S |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | formic acid;1-(3-phenylphenyl)sulfonyl-4-pyridin-2-ylpiperazine |
| SMILES | O=CO.O=S(=O)(c1cccc(-c2ccccc2)c1)N1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C21H21N3O2S.CH2O2/c25-27(26,20-10-6-9-19(17-20)18-7-2-1-3-8-18)24-15-13-23(14-16-24)21-11-4-5-12-22-21;2-1-3/h1-12,17H,13-16H2;1H,(H,2,3) |
| InChIKey | FIXIZZYLSSANFP-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 90.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|