C19H22N4O3S — CID 55915923
N-prop-2-enyl-3-(4-pyridin-2-ylpiperazin-1-yl)sulfonylbenzamide (PubChem CID 55915923) has the molecular formula C19H22N4O3S and a molecular weight of 386.48 g/mol. Its IUPAC name is N-prop-2-enyl-3-(4-pyridin-2-ylpiperazin-1-yl)sulfonylbenzamide.
| Compound Name | N-prop-2-enyl-3-(4-pyridin-2-ylpiperazin-1-yl)sulfonylbenzamide |
|---|---|
| PubChem CID | 55915923 |
| Molecular Formula | C19H22N4O3S |
| Molecular Weight | 386.48 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | N-prop-2-enyl-3-(4-pyridin-2-ylpiperazin-1-yl)sulfonylbenzamide |
| SMILES | C=CCNC(=O)c1cccc(S(=O)(=O)N2CCN(c3ccccn3)CC2)c1 |
| InChI | InChI=1S/C19H22N4O3S/c1-2-9-21-19(24)16-6-5-7-17(15-16)27(25,26)23-13-11-22(12-14-23)18-8-3-4-10-20-18/h2-8,10,15H,1,9,11-14H2,(H,21,24) |
| InChIKey | NIZYUTNPBBKUSY-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.48 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|