C23H29N3O3S — CID 86892603
3-(4-benzyl-3,3-dimethylpiperazin-1-yl)sulfonyl-N-prop-2-enylbenzamide (PubChem CID 86892603) has the molecular formula C23H29N3O3S and a molecular weight of 427.57 g/mol. Its IUPAC name is 3-(4-benzyl-3,3-dimethylpiperazin-1-yl)sulfonyl-N-prop-2-enylbenzamide.
| Compound Name | 3-(4-benzyl-3,3-dimethylpiperazin-1-yl)sulfonyl-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 86892603 |
| Molecular Formula | C23H29N3O3S |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | 3-(4-benzyl-3,3-dimethylpiperazin-1-yl)sulfonyl-N-prop-2-enylbenzamide |
| SMILES | C=CCNC(=O)c1cccc(S(=O)(=O)N2CCN(Cc3ccccc3)C(C)(C)C2)c1 |
| InChI | InChI=1S/C23H29N3O3S/c1-4-13-24-22(27)20-11-8-12-21(16-20)30(28,29)26-15-14-25(23(2,3)18-26)17-19-9-6-5-7-10-19/h4-12,16H,1,13-15,17-18H2,2-3H3,(H,24,27) |
| InChIKey | CQOTVQXPZSMCKG-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|