C23H26N4O3S — CID 55871159
3-[[4-[(4-cyanophenyl)methyl]-1,4-diazepan-1-yl]sulfonyl]-N-prop-2-enylbenzamide (PubChem CID 55871159) has the molecular formula C23H26N4O3S and a molecular weight of 438.55 g/mol. Its IUPAC name is 3-[[4-[(4-cyanophenyl)methyl]-1,4-diazepan-1-yl]sulfonyl]-N-prop-2-enylbenzamide.
| Compound Name | 3-[[4-[(4-cyanophenyl)methyl]-1,4-diazepan-1-yl]sulfonyl]-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 55871159 |
| Molecular Formula | C23H26N4O3S |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | 3-[[4-[(4-cyanophenyl)methyl]-1,4-diazepan-1-yl]sulfonyl]-N-prop-2-enylbenzamide |
| SMILES | C=CCNC(=O)c1cccc(S(=O)(=O)N2CCCN(Cc3ccc(C#N)cc3)CC2)c1 |
| InChI | InChI=1S/C23H26N4O3S/c1-2-11-25-23(28)21-5-3-6-22(16-21)31(29,30)27-13-4-12-26(14-15-27)18-20-9-7-19(17-24)8-10-20/h2-3,5-10,16H,1,4,11-15,18H2,(H,25,28) |
| InChIKey | JSELEUUDCQMAOD-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 93.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|