C16H22N4O4S — CID 51121166
3-[4-(2-amino-2-oxoethyl)piperazin-1-yl]sulfonyl-N-prop-2-enylbenzamide (PubChem CID 51121166) has the molecular formula C16H22N4O4S and a molecular weight of 366.44 g/mol. Its IUPAC name is 3-[4-(2-amino-2-oxoethyl)piperazin-1-yl]sulfonyl-N-prop-2-enylbenzamide.
| Compound Name | 3-[4-(2-amino-2-oxoethyl)piperazin-1-yl]sulfonyl-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 51121166 |
| Molecular Formula | C16H22N4O4S |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | 3-[4-(2-amino-2-oxoethyl)piperazin-1-yl]sulfonyl-N-prop-2-enylbenzamide |
| SMILES | C=CCNC(=O)c1cccc(S(=O)(=O)N2CCN(CC(N)=O)CC2)c1 |
| InChI | InChI=1S/C16H22N4O4S/c1-2-6-18-16(22)13-4-3-5-14(11-13)25(23,24)20-9-7-19(8-10-20)12-15(17)21/h2-5,11H,1,6-10,12H2,(H2,17,21)(H,18,22) |
| InChIKey | XUHNFOUEGZOJDC-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 112.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|