C21H26ClN3O3S — CID 120766363
3-[(3R,4R)-3-(aminomethyl)-4-phenylpyrrolidin-1-yl]sulfonyl-N-prop-2-enylbenzamide;hydrochloride (PubChem CID 120766363) has the molecular formula C21H26ClN3O3S and a molecular weight of 435.98 g/mol. Its IUPAC name is 3-[(3R,4R)-3-(aminomethyl)-4-phenylpyrrolidin-1-yl]sulfonyl-N-prop-2-enylbenzamide;hydrochloride.
| Compound Name | 3-[(3R,4R)-3-(aminomethyl)-4-phenylpyrrolidin-1-yl]sulfonyl-N-prop-2-enylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 120766363 |
| Molecular Formula | C21H26ClN3O3S |
| Molecular Weight | 435.98 g/mol |
| Exact Mass | 435.14 |
| IUPAC Name | 3-[(3R,4R)-3-(aminomethyl)-4-phenylpyrrolidin-1-yl]sulfonyl-N-prop-2-enylbenzamide;hydrochloride |
| SMILES | C=CCNC(=O)c1cccc(S(=O)(=O)N2C[C@@H](CN)[C@H](c3ccccc3)C2)c1.Cl |
| InChI | InChI=1S/C21H25N3O3S.ClH/c1-2-11-23-21(25)17-9-6-10-19(12-17)28(26,27)24-14-18(13-22)20(15-24)16-7-4-3-5-8-16;/h2-10,12,18,20H,1,11,13-15,22H2,(H,23,25);1H/t18-,20+;/m1./s1 |
| InChIKey | CBYJNDKNEURVNH-VDWUQFQWSA-N |
| XLogP | 2.39 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.98 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|