C17H16ClN2O4S- — CID 2369448
2-chloro-5-(4-phenylpiperazin-1-yl)sulfonylbenzoate (PubChem CID 2369448) has the molecular formula C17H16ClN2O4S- and a molecular weight of 379.85 g/mol. Its IUPAC name is 2-chloro-5-(4-phenylpiperazin-1-yl)sulfonylbenzoate.
| Compound Name | 2-chloro-5-(4-phenylpiperazin-1-yl)sulfonylbenzoate |
|---|---|
| PubChem CID | 2369448 |
| Molecular Formula | C17H16ClN2O4S- |
| Molecular Weight | 379.85 g/mol |
| Exact Mass | 379.05 |
| IUPAC Name | 2-chloro-5-(4-phenylpiperazin-1-yl)sulfonylbenzoate |
| SMILES | O=C([O-])c1cc(S(=O)(=O)N2CCN(c3ccccc3)CC2)ccc1Cl |
| InChI | InChI=1S/C17H17ClN2O4S/c18-16-7-6-14(12-15(16)17(21)22)25(23,24)20-10-8-19(9-11-20)13-4-2-1-3-5-13/h1-7,12H,8-11H2,(H,21,22)/p-1 |
| InChIKey | FXETVTWUADLWHG-UHFFFAOYSA-M |
| XLogP | 1.21 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.85 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |