C20H19ClN4O3S2 — CID 2679186
2-chloro-5-(4-phenylpiperazin-1-yl)sulfonyl-N-(1,3-thiazol-2-yl)benzamide (PubChem CID 2679186) has the molecular formula C20H19ClN4O3S2 and a molecular weight of 462.98 g/mol. Its IUPAC name is 2-chloro-5-(4-phenylpiperazin-1-yl)sulfonyl-N-(1,3-thiazol-2-yl)benzamide.
| Compound Name | 2-chloro-5-(4-phenylpiperazin-1-yl)sulfonyl-N-(1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 2679186 |
| Molecular Formula | C20H19ClN4O3S2 |
| Molecular Weight | 462.98 g/mol |
| Exact Mass | 462.06 |
| IUPAC Name | 2-chloro-5-(4-phenylpiperazin-1-yl)sulfonyl-N-(1,3-thiazol-2-yl)benzamide |
| SMILES | O=C(Nc1nccs1)c1cc(S(=O)(=O)N2CCN(c3ccccc3)CC2)ccc1Cl |
| InChI | InChI=1S/C20H19ClN4O3S2/c21-18-7-6-16(14-17(18)19(26)23-20-22-8-13-29-20)30(27,28)25-11-9-24(10-12-25)15-4-2-1-3-5-15/h1-8,13-14H,9-12H2,(H,22,23,26) |
| InChIKey | UNIDOSISOPUZGY-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.98 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |