C14H14ClN3O3S2 — CID 8762849
2-chloro-5-pyrrolidin-1-ylsulfonyl-N-(1,3-thiazol-2-yl)benzamide (PubChem CID 8762849) has the molecular formula C14H14ClN3O3S2 and a molecular weight of 371.87 g/mol. Its IUPAC name is 2-chloro-5-pyrrolidin-1-ylsulfonyl-N-(1,3-thiazol-2-yl)benzamide.
| Compound Name | 2-chloro-5-pyrrolidin-1-ylsulfonyl-N-(1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 8762849 |
| Molecular Formula | C14H14ClN3O3S2 |
| Molecular Weight | 371.87 g/mol |
| Exact Mass | 371.02 |
| IUPAC Name | 2-chloro-5-pyrrolidin-1-ylsulfonyl-N-(1,3-thiazol-2-yl)benzamide |
| SMILES | O=C(Nc1nccs1)c1cc(S(=O)(=O)N2CCCC2)ccc1Cl |
| InChI | InChI=1S/C14H14ClN3O3S2/c15-12-4-3-10(23(20,21)18-6-1-2-7-18)9-11(12)13(19)17-14-16-5-8-22-14/h3-5,8-9H,1-2,6-7H2,(H,16,17,19) |
| InChIKey | VUVBLAUGGYSWDM-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.87 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |