C22H22ClN5O5S2 — CID 43876591
2-chloro-5-piperidin-1-ylsulfonyl-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]benzamide (PubChem CID 43876591) has the molecular formula C22H22ClN5O5S2 and a molecular weight of 536.04 g/mol. Its IUPAC name is 2-chloro-5-piperidin-1-ylsulfonyl-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]benzamide.
| Compound Name | 2-chloro-5-piperidin-1-ylsulfonyl-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 43876591 |
| Molecular Formula | C22H22ClN5O5S2 |
| Molecular Weight | 536.04 g/mol |
| Exact Mass | 535.08 |
| IUPAC Name | 2-chloro-5-piperidin-1-ylsulfonyl-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]benzamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)Nc2ncccn2)cc1)c1cc(S(=O)(=O)N2CCCCC2)ccc1Cl |
| InChI | InChI=1S/C22H22ClN5O5S2/c23-20-10-9-18(35(32,33)28-13-2-1-3-14-28)15-19(20)21(29)26-16-5-7-17(8-6-16)34(30,31)27-22-24-11-4-12-25-22/h4-12,15H,1-3,13-14H2,(H,26,29)(H,24,25,27) |
| InChIKey | CJLMFYUIKPRYRZ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 138.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.04 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |