C17H21N3O3S2 — CID 8762980
3-(4-piperidin-1-ylsulfonylphenyl)-N-(1,3-thiazol-2-yl)propanamide (PubChem CID 8762980) has the molecular formula C17H21N3O3S2 and a molecular weight of 379.51 g/mol. Its IUPAC name is 3-(4-piperidin-1-ylsulfonylphenyl)-N-(1,3-thiazol-2-yl)propanamide.
| Compound Name | 3-(4-piperidin-1-ylsulfonylphenyl)-N-(1,3-thiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 8762980 |
| Molecular Formula | C17H21N3O3S2 |
| Molecular Weight | 379.51 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | 3-(4-piperidin-1-ylsulfonylphenyl)-N-(1,3-thiazol-2-yl)propanamide |
| SMILES | O=C(CCc1ccc(S(=O)(=O)N2CCCCC2)cc1)Nc1nccs1 |
| InChI | InChI=1S/C17H21N3O3S2/c21-16(19-17-18-10-13-24-17)9-6-14-4-7-15(8-5-14)25(22,23)20-11-2-1-3-12-20/h4-5,7-8,10,13H,1-3,6,9,11-12H2,(H,18,19,21) |
| InChIKey | CLUXCBIXRJBEKS-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.51 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |