C18H20N2O4S — CID 45466358
2-methyl-5-(4-phenylpiperazin-1-yl)sulfonylbenzoic acid (PubChem CID 45466358) has the molecular formula C18H20N2O4S and a molecular weight of 360.44 g/mol. Its IUPAC name is 2-methyl-5-(4-phenylpiperazin-1-yl)sulfonylbenzoic acid.
| Compound Name | 2-methyl-5-(4-phenylpiperazin-1-yl)sulfonylbenzoic acid |
|---|---|
| PubChem CID | 45466358 |
| Molecular Formula | C18H20N2O4S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | 2-methyl-5-(4-phenylpiperazin-1-yl)sulfonylbenzoic acid |
| SMILES | Cc1ccc(S(=O)(=O)N2CCN(c3ccccc3)CC2)cc1C(=O)O |
| InChI | InChI=1S/C18H20N2O4S/c1-14-7-8-16(13-17(14)18(21)22)25(23,24)20-11-9-19(10-12-20)15-5-3-2-4-6-15/h2-8,13H,9-12H2,1H3,(H,21,22) |
| InChIKey | WQOBMTMDIJXLPM-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |