C23H30ClN3O5S — CID 25408393
2-chloro-N,N-bis(2-methoxyethyl)-5-(4-phenylpiperazin-1-yl)sulfonylbenzamide (PubChem CID 25408393) has the molecular formula C23H30ClN3O5S and a molecular weight of 496.03 g/mol. Its IUPAC name is 2-chloro-N,N-bis(2-methoxyethyl)-5-(4-phenylpiperazin-1-yl)sulfonylbenzamide.
| Compound Name | 2-chloro-N,N-bis(2-methoxyethyl)-5-(4-phenylpiperazin-1-yl)sulfonylbenzamide |
|---|---|
| PubChem CID | 25408393 |
| Molecular Formula | C23H30ClN3O5S |
| Molecular Weight | 496.03 g/mol |
| Exact Mass | 495.16 |
| IUPAC Name | 2-chloro-N,N-bis(2-methoxyethyl)-5-(4-phenylpiperazin-1-yl)sulfonylbenzamide |
| SMILES | COCCN(CCOC)C(=O)c1cc(S(=O)(=O)N2CCN(c3ccccc3)CC2)ccc1Cl |
| InChI | InChI=1S/C23H30ClN3O5S/c1-31-16-14-26(15-17-32-2)23(28)21-18-20(8-9-22(21)24)33(29,30)27-12-10-25(11-13-27)19-6-4-3-5-7-19/h3-9,18H,10-17H2,1-2H3 |
| InChIKey | GUJSHSJDWFBXRC-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 79.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.03 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |