C16H24ClN3O3S — CID 99969320
2-chloro-N,N-diethyl-5-(4-methylpiperazin-1-yl)sulfonylbenzamide (PubChem CID 99969320) has the molecular formula C16H24ClN3O3S and a molecular weight of 373.91 g/mol. Its IUPAC name is 2-chloro-N,N-diethyl-5-(4-methylpiperazin-1-yl)sulfonylbenzamide.
| Compound Name | 2-chloro-N,N-diethyl-5-(4-methylpiperazin-1-yl)sulfonylbenzamide |
|---|---|
| PubChem CID | 99969320 |
| Molecular Formula | C16H24ClN3O3S |
| Molecular Weight | 373.91 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | 2-chloro-N,N-diethyl-5-(4-methylpiperazin-1-yl)sulfonylbenzamide |
| SMILES | CCN(CC)C(=O)c1cc(S(=O)(=O)N2CCN(C)CC2)ccc1Cl |
| InChI | InChI=1S/C16H24ClN3O3S/c1-4-19(5-2)16(21)14-12-13(6-7-15(14)17)24(22,23)20-10-8-18(3)9-11-20/h6-7,12H,4-5,8-11H2,1-3H3 |
| InChIKey | PTUCBPDXJWSRKV-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.91 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |