C21H26ClN3O3S — CID 99969454
2-chloro-N-methyl-N-[(4-methylphenyl)methyl]-5-(4-methylpiperazin-1-yl)sulfonylbenzamide (PubChem CID 99969454) has the molecular formula C21H26ClN3O3S and a molecular weight of 435.98 g/mol. Its IUPAC name is 2-chloro-N-methyl-N-[(4-methylphenyl)methyl]-5-(4-methylpiperazin-1-yl)sulfonylbenzamide.
| Compound Name | 2-chloro-N-methyl-N-[(4-methylphenyl)methyl]-5-(4-methylpiperazin-1-yl)sulfonylbenzamide |
|---|---|
| PubChem CID | 99969454 |
| Molecular Formula | C21H26ClN3O3S |
| Molecular Weight | 435.98 g/mol |
| Exact Mass | 435.14 |
| IUPAC Name | 2-chloro-N-methyl-N-[(4-methylphenyl)methyl]-5-(4-methylpiperazin-1-yl)sulfonylbenzamide |
| SMILES | Cc1ccc(CN(C)C(=O)c2cc(S(=O)(=O)N3CCN(C)CC3)ccc2Cl)cc1 |
| InChI | InChI=1S/C21H26ClN3O3S/c1-16-4-6-17(7-5-16)15-24(3)21(26)19-14-18(8-9-20(19)22)29(27,28)25-12-10-23(2)11-13-25/h4-9,14H,10-13,15H2,1-3H3 |
| InChIKey | QYFKJBJMPMABFK-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.98 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |