C17H19ClN2O3S2 — CID 18127125
2-chloro-N-methyl-5-pyrrolidin-1-ylsulfonyl-N-(thiophen-3-ylmethyl)benzamide (PubChem CID 18127125) has the molecular formula C17H19ClN2O3S2 and a molecular weight of 398.94 g/mol. Its IUPAC name is 2-chloro-N-methyl-5-pyrrolidin-1-ylsulfonyl-N-(thiophen-3-ylmethyl)benzamide.
| Compound Name | 2-chloro-N-methyl-5-pyrrolidin-1-ylsulfonyl-N-(thiophen-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 18127125 |
| Molecular Formula | C17H19ClN2O3S2 |
| Molecular Weight | 398.94 g/mol |
| Exact Mass | 398.05 |
| IUPAC Name | 2-chloro-N-methyl-5-pyrrolidin-1-ylsulfonyl-N-(thiophen-3-ylmethyl)benzamide |
| SMILES | CN(Cc1ccsc1)C(=O)c1cc(S(=O)(=O)N2CCCC2)ccc1Cl |
| InChI | InChI=1S/C17H19ClN2O3S2/c1-19(11-13-6-9-24-12-13)17(21)15-10-14(4-5-16(15)18)25(22,23)20-7-2-3-8-20/h4-6,9-10,12H,2-3,7-8,11H2,1H3 |
| InChIKey | STDSKHQDUCVULB-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.94 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |