C19H25N3O3S2 — CID 9054681
(2R)-2-[methyl(thiophen-3-ylmethyl)amino]-N-(4-pyrrolidin-1-ylsulfonylphenyl)propanamide (PubChem CID 9054681) has the molecular formula C19H25N3O3S2 and a molecular weight of 407.56 g/mol. Its IUPAC name is (2R)-2-[methyl(thiophen-3-ylmethyl)amino]-N-(4-pyrrolidin-1-ylsulfonylphenyl)propanamide.
| Compound Name | (2R)-2-[methyl(thiophen-3-ylmethyl)amino]-N-(4-pyrrolidin-1-ylsulfonylphenyl)propanamide |
|---|---|
| PubChem CID | 9054681 |
| Molecular Formula | C19H25N3O3S2 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | (2R)-2-[methyl(thiophen-3-ylmethyl)amino]-N-(4-pyrrolidin-1-ylsulfonylphenyl)propanamide |
| SMILES | C[C@H](C(=O)Nc1ccc(S(=O)(=O)N2CCCC2)cc1)N(C)Cc1ccsc1 |
| InChI | InChI=1S/C19H25N3O3S2/c1-15(21(2)13-16-9-12-26-14-16)19(23)20-17-5-7-18(8-6-17)27(24,25)22-10-3-4-11-22/h5-9,12,14-15H,3-4,10-11,13H2,1-2H3,(H,20,23)/t15-/m1/s1 |
| InChIKey | MCBGHKJEZQKMBW-OAHLLOKOSA-N |
| XLogP | 2.99 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |