C18H26ClN3O5S — CID 55343818
2-chloro-N-ethyl-5-morpholin-4-ylsulfonyl-N-[2-oxo-2-(propan-2-ylamino)ethyl]benzamide (PubChem CID 55343818) has the molecular formula C18H26ClN3O5S and a molecular weight of 431.94 g/mol. Its IUPAC name is 2-chloro-N-ethyl-5-morpholin-4-ylsulfonyl-N-[2-oxo-2-(propan-2-ylamino)ethyl]benzamide.
| Compound Name | 2-chloro-N-ethyl-5-morpholin-4-ylsulfonyl-N-[2-oxo-2-(propan-2-ylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 55343818 |
| Molecular Formula | C18H26ClN3O5S |
| Molecular Weight | 431.94 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | 2-chloro-N-ethyl-5-morpholin-4-ylsulfonyl-N-[2-oxo-2-(propan-2-ylamino)ethyl]benzamide |
| SMILES | CCN(CC(=O)NC(C)C)C(=O)c1cc(S(=O)(=O)N2CCOCC2)ccc1Cl |
| InChI | InChI=1S/C18H26ClN3O5S/c1-4-21(12-17(23)20-13(2)3)18(24)15-11-14(5-6-16(15)19)28(25,26)22-7-9-27-10-8-22/h5-6,11,13H,4,7-10,12H2,1-3H3,(H,20,23) |
| InChIKey | NFOVQWPIVNLOIV-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.94 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |