C22H31ClN2O3S — CID 55593828
2-chloro-N-cyclopropyl-N-(4-ethylcyclohexyl)-5-pyrrolidin-1-ylsulfonylbenzamide (PubChem CID 55593828) has the molecular formula C22H31ClN2O3S and a molecular weight of 439.02 g/mol. Its IUPAC name is 2-chloro-N-cyclopropyl-N-(4-ethylcyclohexyl)-5-pyrrolidin-1-ylsulfonylbenzamide.
| Compound Name | 2-chloro-N-cyclopropyl-N-(4-ethylcyclohexyl)-5-pyrrolidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 55593828 |
| Molecular Formula | C22H31ClN2O3S |
| Molecular Weight | 439.02 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | 2-chloro-N-cyclopropyl-N-(4-ethylcyclohexyl)-5-pyrrolidin-1-ylsulfonylbenzamide |
| SMILES | CCC1CCC(N(C(=O)c2cc(S(=O)(=O)N3CCCC3)ccc2Cl)C2CC2)CC1 |
| InChI | InChI=1S/C22H31ClN2O3S/c1-2-16-5-7-17(8-6-16)25(18-9-10-18)22(26)20-15-19(11-12-21(20)23)29(27,28)24-13-3-4-14-24/h11-12,15-18H,2-10,13-14H2,1H3 |
| InChIKey | YYKIMUDPLIPVHO-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.02 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |