C20H18ClN5O — CID 78333510
2-[4-[(5-chloro-8-hydroxyquinolin-7-yl)methyl]piperazin-1-yl]pyridine-4-carbonitrile (PubChem CID 78333510) has the molecular formula C20H18ClN5O and a molecular weight of 379.85 g/mol. Its IUPAC name is 2-[4-[(5-chloro-8-hydroxyquinolin-7-yl)methyl]piperazin-1-yl]pyridine-4-carbonitrile.
| Compound Name | 2-[4-[(5-chloro-8-hydroxyquinolin-7-yl)methyl]piperazin-1-yl]pyridine-4-carbonitrile |
|---|---|
| PubChem CID | 78333510 |
| Molecular Formula | C20H18ClN5O |
| Molecular Weight | 379.85 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | 2-[4-[(5-chloro-8-hydroxyquinolin-7-yl)methyl]piperazin-1-yl]pyridine-4-carbonitrile |
| SMILES | N#Cc1ccnc(N2CCN(Cc3cc(Cl)c4cccnc4c3O)CC2)c1 |
| InChI | InChI=1S/C20H18ClN5O/c21-17-11-15(20(27)19-16(17)2-1-4-24-19)13-25-6-8-26(9-7-25)18-10-14(12-22)3-5-23-18/h1-5,10-11,27H,6-9,13H2 |
| InChIKey | VBYDMKHREXNELK-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 76.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.85 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|