C22H30ClN3O3S3 — CID 11103280
16-[(5-chloro-8-hydroxyquinolin-7-yl)methyl]-1-oxa-7,10,13-trithia-4,16-diazacyclooctadecan-5-one (PubChem CID 11103280) has the molecular formula C22H30ClN3O3S3 and a molecular weight of 516.15 g/mol. Its IUPAC name is 16-[(5-chloro-8-hydroxyquinolin-7-yl)methyl]-1-oxa-7,10,13-trithia-4,16-diazacyclooctadecan-5-one.
| Compound Name | 16-[(5-chloro-8-hydroxyquinolin-7-yl)methyl]-1-oxa-7,10,13-trithia-4,16-diazacyclooctadecan-5-one |
|---|---|
| PubChem CID | 11103280 |
| Molecular Formula | C22H30ClN3O3S3 |
| Molecular Weight | 516.15 g/mol |
| Exact Mass | 515.11 |
| IUPAC Name | 16-[(5-chloro-8-hydroxyquinolin-7-yl)methyl]-1-oxa-7,10,13-trithia-4,16-diazacyclooctadecan-5-one |
| SMILES | O=C1CSCCSCCSCCN(Cc2cc(Cl)c3cccnc3c2O)CCOCCN1 |
| InChI | InChI=1S/C22H30ClN3O3S3/c23-19-14-17(22(28)21-18(19)2-1-3-25-21)15-26-5-8-29-7-4-24-20(27)16-32-13-12-31-11-10-30-9-6-26/h1-3,14,28H,4-13,15-16H2,(H,24,27) |
| InChIKey | XVMXCRHKFVKLTI-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.15 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|