C23H27N4OS+ — CID 3314654
N-[5-ethyl-3-[(4-pyridin-2-ylpiperazin-1-ium-1-yl)methyl]thiophen-2-yl]benzamide (PubChem CID 3314654) has the molecular formula C23H27N4OS+ and a molecular weight of 407.56 g/mol. Its IUPAC name is N-[5-ethyl-3-[(4-pyridin-2-ylpiperazin-1-ium-1-yl)methyl]thiophen-2-yl]benzamide.
| Compound Name | N-[5-ethyl-3-[(4-pyridin-2-ylpiperazin-1-ium-1-yl)methyl]thiophen-2-yl]benzamide |
|---|---|
| PubChem CID | 3314654 |
| Molecular Formula | C23H27N4OS+ |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.19 |
| IUPAC Name | N-[5-ethyl-3-[(4-pyridin-2-ylpiperazin-1-ium-1-yl)methyl]thiophen-2-yl]benzamide |
| SMILES | CCc1cc(C[NH+]2CCN(c3ccccn3)CC2)c(NC(=O)c2ccccc2)s1 |
| InChI | InChI=1S/C23H26N4OS/c1-2-20-16-19(23(29-20)25-22(28)18-8-4-3-5-9-18)17-26-12-14-27(15-13-26)21-10-6-7-11-24-21/h3-11,16H,2,12-15,17H2,1H3,(H,25,28)/p+1 |
| InChIKey | KCGVBUXJQOASJO-UHFFFAOYSA-O |
| XLogP | 2.86 |
| TPSA | 49.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |