C32H35N3O2S — CID 42504511
N-[3-[(R)-(4-ethoxyphenyl)-(4-phenylpiperazin-1-yl)methyl]-5-ethylthiophen-2-yl]benzamide (PubChem CID 42504511) has the molecular formula C32H35N3O2S and a molecular weight of 525.72 g/mol. Its IUPAC name is N-[3-[(R)-(4-ethoxyphenyl)-(4-phenylpiperazin-1-yl)methyl]-5-ethylthiophen-2-yl]benzamide.
| Compound Name | N-[3-[(R)-(4-ethoxyphenyl)-(4-phenylpiperazin-1-yl)methyl]-5-ethylthiophen-2-yl]benzamide |
|---|---|
| PubChem CID | 42504511 |
| Molecular Formula | C32H35N3O2S |
| Molecular Weight | 525.72 g/mol |
| Exact Mass | 525.24 |
| IUPAC Name | N-[3-[(R)-(4-ethoxyphenyl)-(4-phenylpiperazin-1-yl)methyl]-5-ethylthiophen-2-yl]benzamide |
| SMILES | CCOc1ccc([C@H](c2cc(CC)sc2NC(=O)c2ccccc2)N2CCN(c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C32H35N3O2S/c1-3-28-23-29(32(38-28)33-31(36)25-11-7-5-8-12-25)30(24-15-17-27(18-16-24)37-4-2)35-21-19-34(20-22-35)26-13-9-6-10-14-26/h5-18,23,30H,3-4,19-22H2,1-2H3,(H,33,36)/t30-/m1/s1 |
| InChIKey | CNKIEQBJIAKYBT-SSEXGKCCSA-N |
| XLogP | 6.87 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.72 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |